CymitQuimica logo

CAS 1215206-30-6

:

3′-(Trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-(Trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a trifluoromethoxy group (-O-CF3) at the 3′ position of one of the phenyl rings significantly influences its chemical properties, including its reactivity and polarity. The carboxylic acid functional group (-COOH) at the 3 position contributes to its acidity and potential for hydrogen bonding, making it soluble in polar solvents. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its trifluoromethoxy substituent can enhance lipophilicity and metabolic stability, which are desirable traits in pharmaceutical compounds. Overall, 3′-(Trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid exhibits unique characteristics that make it a valuable compound for research and development.
Formula:C14H9F3O3
InChI:InChI=1S/C14H9F3O3/c15-14(16,17)20-12-6-2-4-10(8-12)9-3-1-5-11(7-9)13(18)19/h1-8H,(H,18,19)
InChI key:InChIKey=FJNYSKXDNSOFOH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC(OC(F)(F)F)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-(trifluoromethoxy)-
  • 3′-(Trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.