CAS 1215206-31-7
:2′-Bromo-3′-methyl[1,1′-biphenyl]-3-carboxylic acid
Description:
2′-Bromo-3′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 2' position and a methyl group at the 3' position on one of the phenyl rings contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting reactivity due to the electron-withdrawing effects of the bromine atom and the steric hindrance introduced by the methyl group, which can influence its behavior in chemical reactions, such as electrophilic substitution or coupling reactions. Additionally, the compound's structural features may impart specific biological activities or interactions, making it of interest in medicinal chemistry or materials science. Its CAS number, 1215206-31-7, allows for precise identification and retrieval of information regarding its properties and applications in scientific literature.
Formula:C14H11BrO2
InChI:InChI=1S/C14H11BrO2/c1-9-4-2-7-12(13(9)15)10-5-3-6-11(8-10)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=GVRQICXYZWJICO-UHFFFAOYSA-N
SMILES:BrC1=C(C2=CC(C(O)=O)=CC=C2)C=CC=C1C
Synonyms:- 2′-Bromo-3′-methyl[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 2′-bromo-3′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
