CAS 1215206-33-9

2′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2' position and a methyl group at the 4' position on one of the phenyl rings contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its molecular interactions can be influenced by the electron-withdrawing nature of the fluorine atom and the steric effects of the methyl group. Additionally, the compound's stability, reactivity, and potential applications in synthesis or as a pharmaceutical intermediate can be explored further in research contexts. Overall, 2′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid represents a versatile structure in organic chemistry.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1S/C14H11FO2/c1-9-5-6-12(13(15)7-9)10-3-2-4-11(8-10)14(16)17/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=YJUVMAOSWHFUOK-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(C(O)=O)=CC=C2)C=CC(C)=C1

Synonyms:

• 2′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-fluoro-4′-methyl-

2'-Fluoro-4'-methylbiphenyl-3-carboxylic acid

CAS: 1215206-33-9

Formula: C₁₄H₁₁FO₂

Molecular weight: 230.2343

Ref: IN-DA00156W