CAS 1215206-34-0
:Quinoline, 6-(trifluoromethoxy)-, hydrochloride (1:1)
Description:
Quinoline, 6-(trifluoromethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure containing a nitrogen atom. The presence of a trifluoromethoxy group at the 6-position enhances its chemical reactivity and influences its solubility and polarity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly for its potential use in drug development. Its trifluoromethoxy substituent can impart unique electronic properties, potentially affecting its interaction with biological targets. Safety data and handling precautions should be considered, as with any chemical, due to potential toxicity or reactivity. Overall, Quinoline, 6-(trifluoromethoxy)-, hydrochloride is a specialized compound with distinct characteristics that make it valuable in research and development contexts.
Formula:C10H6F3NO·ClH
InChI:InChI=1S/C10H6F3NO.ClH/c11-10(12,13)15-8-3-4-9-7(6-8)2-1-5-14-9;/h1-6H;1H
InChI key:InChIKey=YXYBRJPHNSMIAC-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC2=C(C=C1)N=CC=C2.Cl
Synonyms:- 6-(Trifluoromethoxy)quinoline HCl
- A-5478
- I08-991
- Quinoline, 6-(trifluoromethoxy)-, hydrochloride (1:1)
- 6-(Trifluoromethoxy)quinoline hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
