CAS 1215206-36-2
:5-(Trifluoromethoxy)-2,1,3-benzothiadiazole
Description:
5-(Trifluoromethoxy)-2,1,3-benzothiadiazole is a chemical compound characterized by its unique structure, which includes a benzothiadiazole core substituted with a trifluoromethoxy group. This compound typically exhibits properties associated with both the benzothiadiazole and trifluoromethoxy functional groups, such as potential applications in organic electronics, fluorescence, and as a building block in the synthesis of more complex molecules. The presence of the trifluoromethoxy group enhances its electron-withdrawing characteristics, which can influence its reactivity and solubility in various solvents. Additionally, compounds like this one are often studied for their photophysical properties, making them of interest in fields such as materials science and medicinal chemistry. The CAS number 1215206-36-2 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 5-(Trifluoromethoxy)-2,1,3-benzothiadiazole is a valuable compound in research and development, particularly in the context of advanced materials and organic synthesis.
Formula:C7H3F3N2OS
InChI:InChI=1S/C7H3F3N2OS/c8-7(9,10)13-4-1-2-5-6(3-4)12-14-11-5/h1-3H
InChI key:InChIKey=PMFZQWARKYEPDS-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=2C(C=C1)=NSN2
Synonyms:- 2,1,3-Benzothiadiazole, 5-(trifluoromethoxy)-
- 5-(Trifluoromethoxy)-2,1,3-benzothiadiazole
- 5-(Trifluoromethoxy)benzo-2,1,3-thiadiazole
- 5-(Trifluoromethoxy)benzo[c][1,2,5]thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
