CymitQuimica logo

CAS 1215206-45-3

:

2′-(Aminosulfonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-(Aminosulfonyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an aminosulfonyl group indicates that the compound contains a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The carboxylic acid group contributes to the compound's acidity and reactivity, making it a potential candidate for various applications in pharmaceuticals and organic synthesis. This compound may exhibit properties such as solubility in polar solvents, and its functional groups can influence its biological activity, potentially making it useful in medicinal chemistry. Additionally, the structural features suggest that it could interact with biological targets, which is of interest in drug development. Overall, the combination of these functional groups and the biphenyl framework provides a unique profile that may be explored for various chemical and biological applications.
Formula:C13H11NO4S
InChI:InChI=1S/C13H11NO4S/c14-19(17,18)12-7-2-1-6-11(12)9-4-3-5-10(8-9)13(15)16/h1-8H,(H,15,16)(H2,14,17,18)
InChI key:InChIKey=GHTXHTSFJAZACO-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(C=CC=C1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • 2′-(Aminosulfonyl)[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-(aminosulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.