CymitQuimica logo

CAS 1215206-46-4

:

3′-Chloro-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Chloro-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position of the biphenyl framework contributes to its acidic properties and potential reactivity in various chemical reactions. The chlorine atom at the 3′ position and the methoxy group (-OCH3) at the 5′ position introduce specific electronic and steric effects, influencing the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, agrochemicals, or as a building block in the development of more complex molecules. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H11ClO3
InChI:InChI=1S/C14H11ClO3/c1-18-13-7-11(6-12(15)8-13)9-3-2-4-10(5-9)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=HTTQWXUOAKRUBK-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC(OC)=CC(Cl)=C2
Synonyms:
  • 3′-Chloro-5′-methoxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-chloro-5′-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.