CymitQuimica logo

CAS 1215206-49-7

:

4-Bromo-6-chloro-2,1,3-benzothiadiazole

Description:
4-Bromo-6-chloro-2,1,3-benzothiadiazole is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a benzothiadiazole core. This compound features a benzene ring fused to a thiadiazole ring, which contains nitrogen and sulfur atoms, contributing to its unique chemical properties. The presence of halogens (bromine and chlorine) typically enhances the compound's reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of nucleophiles or electrophiles in its environment. Additionally, its solubility may vary depending on the solvent used, and it may exhibit specific optical or electronic properties due to its structural characteristics. Overall, 4-Bromo-6-chloro-2,1,3-benzothiadiazole is an important compound in organic chemistry, particularly in the development of functional materials and biologically active molecules.
Formula:C6H2BrClN2S
InChI:InChI=1S/C6H2BrClN2S/c7-4-1-3(8)2-5-6(4)10-11-9-5/h1-2H
InChI key:InChIKey=CKCVNBIVPGTEST-UHFFFAOYSA-N
SMILES:BrC=1C=2C(C=C(Cl)C1)=NSN2
Synonyms:
  • 2,1,3-Benzothiadiazole, 4-bromo-6-chloro-
  • 4-Bromo-6-chloro-2,1,3-benzothiadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.