CAS 1215206-57-7
:5-Bromo-2-butoxypyrimidine
Description:
5-Bromo-2-butoxypyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position introduces a halogen substituent, which can influence the compound's reactivity and solubility. The butoxy group at the 2-position enhances the compound's lipophilicity, potentially affecting its biological activity and interaction with other molecules. This compound may exhibit properties typical of pyrimidine derivatives, such as involvement in nucleic acid synthesis or acting as a building block in pharmaceuticals. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. Additionally, the presence of both a halogen and an ether functional group may provide unique reactivity patterns in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H11BrN2O
InChI:InChI=1S/C8H11BrN2O/c1-2-3-4-12-8-10-5-7(9)6-11-8/h5-6H,2-4H2,1H3
InChI key:InChIKey=QSKVKWALGAQJRQ-UHFFFAOYSA-N
SMILES:O(CCCC)C=1N=CC(Br)=CN1
Synonyms:- Pyrimidine, 5-bromo-2-butoxy-
- 5-Bromo-2-butoxypyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
