CymitQuimica logo

CAS 1215206-59-9

:

3′-Methoxy-4′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Methoxy-4′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the 3' position and a methyl group (-CH3) at the 4' position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the carboxylic acid functional group (-COOH) at the 3 position enhances its acidity and solubility in polar solvents. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, and its substituents can influence its reactivity and stability. The compound's CAS number, 1215206-59-9, provides a unique identifier for regulatory and research purposes. Overall, 3′-Methoxy-4′-methyl[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-10-6-7-12(9-14(10)18-2)11-4-3-5-13(8-11)15(16)17/h3-9H,1-2H3,(H,16,17)
InChI key:InChIKey=SLWJRQGPKGBLCZ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1C)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-methoxy-4′-methyl-
  • 3′-Methoxy-4′-methyl[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.