CAS 1215206-63-5
:3′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid
Description:
3′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methylamino group at the 3′ position enhances its potential for hydrogen bonding and influences its solubility and reactivity. The carboxylic acid functional group at the 3 position contributes to its acidity and can participate in various chemical reactions, such as esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, 3′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid represents a versatile structure with implications in both synthetic and medicinal chemistry.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-15-13-7-3-5-11(9-13)10-4-2-6-12(8-10)14(16)17/h2-9,15H,1H3,(H,16,17)
InChI key:InChIKey=LJUHYKRGPWUDER-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC(NC)=CC=C2
Synonyms:- 3′-(Methylamino)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 3′-(methylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
