CAS 1215206-64-6

2′-Bromo-4′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Bromo-4′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 2' position and a methyl group at the 4' position on one of the phenyl rings contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic biphenyl structure. Additionally, the presence of the bromine atom may impart some degree of electrophilicity, making it useful in substitution reactions. Its specific applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the potential hazards associated with brominated compounds.

Formula: C₁₄H₁₁BrO₂

InChI: InChI=1S/C14H11BrO2/c1-9-5-6-12(13(15)7-9)10-3-2-4-11(8-10)14(16)17/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=XCSLBLBIRRDRPC-UHFFFAOYSA-N

SMILES: BrC1=C(C2=CC(C(O)=O)=CC=C2)C=CC(C)=C1

Synonyms:

• 2′-Bromo-4′-methyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-bromo-4′-methyl-
• 2-BroMo-4-Methylbiphenyl-3-carboxylic acid
• 2'-Bromo-4'-methylbiphenyl-3-carboxylic acid

2'-Bromo-4'-methylbiphenyl-3-carboxylic acid

CAS: 1215206-64-6

Formula: C₁₄H₁₁BrO₂

Molecular weight: 291.1399

Ref: IN-DA00157G