CAS 1215206-67-9
:2′-Methoxy-6′-methyl[1,1′-biphenyl]-3-carboxylic acid
Description:
2′-Methoxy-6′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH₃) at the 2′ position and a methyl group (-CH₃) at the 6′ position on one of the phenyl rings contributes to its unique chemical properties, including potential variations in solubility and reactivity. The carboxylic acid functional group (-COOH) at the 3-position enhances its acidity and polar character, making it more soluble in polar solvents. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors and the presence of other functional groups.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-10-5-3-8-13(18-2)14(10)11-6-4-7-12(9-11)15(16)17/h3-9H,1-2H3,(H,16,17)
InChI key:InChIKey=UVARBIBHVOPEJJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C)=CC=C1)C2=CC(C(O)=O)=CC=C2
Synonyms:- 2′-Methoxy-6′-methyl[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 2′-methoxy-6′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
