CymitQuimica logo

CAS 1215206-73-7

:

1H-Benzimidazole, 6-bromo-, hydrochloride (1:1)

Description:
1H-Benzimidazole, 6-bromo-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. The presence of a bromine atom at the 6-position of the benzimidazole ring introduces halogen functionality, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and the bromine substituent can also serve as a site for further chemical modifications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogenated groups, due to potential toxicity or environmental impact.
Formula:C7H5BrN2·ClH
InChI:InChI=1S/C7H5BrN2.ClH/c8-5-1-2-6-7(3-5)10-4-9-6;/h1-4H,(H,9,10);1H
InChI key:InChIKey=XOFYSWUSRKXLSI-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=CC1)NC=N2.Cl
Synonyms:
  • 1H-Benzimidazole, 6-bromo-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.