CymitQuimica logo

CAS 1215206-75-9

:

3′-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to the biphenyl framework, contributing to its chemical reactivity and potential biological activity. The carboxylic acid functional group (-COOH) at the 3-position enhances its acidity and solubility in polar solvents. The presence of these functional groups suggests that the compound may exhibit properties such as antioxidant activity or potential use in pharmaceuticals. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound's specific stereochemistry and substituent positions can affect its pharmacokinetics and pharmacodynamics, making it a subject of interest in medicinal chemistry and material science. Overall, this compound's unique structural features contribute to its potential applications in various fields, including drug development and organic synthesis.
Formula:C14H12O4
InChI:InChI=1S/C14H12O4/c1-18-13-6-5-10(8-12(13)15)9-3-2-4-11(7-9)14(16)17/h2-8,15H,1H3,(H,16,17)
InChI key:InChIKey=HKMYZFWAPNUGQJ-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1OC)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • 3′-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-hydroxy-4′-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.