CAS 1215206-77-1

2′-Chloro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Chloro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The chlorine substituent at the 2′ position and the methyl group at the 4′ position on the biphenyl framework influence its electronic properties and steric hindrance, which can affect its interactions in biological systems and its solubility in different solvents. This compound may exhibit interesting biological activities due to its structural features, making it of interest in pharmaceutical and agrochemical research. Additionally, its unique combination of functional groups may allow for further derivatization, expanding its potential applications in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₄H₁₁ClO₂

InChI: InChI=1S/C14H11ClO2/c1-9-5-6-12(13(15)7-9)10-3-2-4-11(8-10)14(16)17/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=LQEIITZDAWEDHD-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(C(O)=O)=CC=C2)C=CC(C)=C1

Synonyms:

• 2′-Chloro-4′-methyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-chloro-4′-methyl-

2'-Chloro-4'-methylbiphenyl-3-carboxylic acid

CAS: 1215206-77-1

Formula: C₁₄H₁₁ClO₂

Molecular weight: 246.6889

Ref: IN-DA001588