CAS 1215206-78-2

2′,3′-Dimethyl[1,1′-biphenyl]-3-carboxylic acid

Description:

2′,3′-Dimethyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two methyl groups at the 2′ and 3′ positions on one of the phenyl rings contributes to its unique properties, including its hydrophobic nature and potential for steric hindrance. The carboxylic acid functional group at the 3-position introduces acidity and polar characteristics, allowing for potential interactions with other polar molecules. This compound may exhibit interesting chemical reactivity, including the ability to participate in esterification or amidation reactions. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as a building block in materials science. Additionally, the compound's solubility and stability can be influenced by the presence of the methyl groups and the carboxylic acid, making it a subject of interest in various chemical studies. Overall, 2′,3′-Dimethyl[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential implications in multiple fields of chemistry.

Formula: C₁₅H₁₄O₂

InChI: InChI=1S/C15H14O2/c1-10-5-3-8-14(11(10)2)12-6-4-7-13(9-12)15(16)17/h3-9H,1-2H3,(H,16,17)

InChI key: InChIKey=NZCHUDYYICLURF-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C(O)=O)=CC=C2)C=CC=C1C

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 2′,3′-dimethyl-
• 2′,3′-Dimethyl[1,1′-biphenyl]-3-carboxylic acid
• 2,3-DiMethylbiphenyl-3-carboxylic acid

2',3'-Dimethylbiphenyl-3-carboxylic acid

CAS: 1215206-78-2

Formula: C₁₅H₁₄O₂

Molecular weight: 226.2705

Ref: IN-DA001587