CAS 121521-90-2
:Salvianolic acid B
Description:
Salvianolic acid B is a phenolic compound primarily derived from the roots of Salvia miltiorrhiza, commonly known as Danshen, which is widely used in traditional Chinese medicine. This compound is known for its antioxidant, anti-inflammatory, and cardioprotective properties. Structurally, it features multiple hydroxyl groups, contributing to its ability to scavenge free radicals and modulate various biochemical pathways. Salvianolic acid B has been studied for its potential therapeutic effects in cardiovascular diseases, neuroprotection, and as an adjunct in cancer treatment due to its ability to inhibit tumor growth and metastasis. Additionally, it exhibits a range of pharmacological activities, including anti-coagulant effects and the ability to improve blood circulation. Its solubility in water and organic solvents varies, which can influence its bioavailability and therapeutic efficacy. Overall, Salvianolic acid B represents a significant area of interest in pharmacology and natural product chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential clinical applications.
Formula:C36H30O16
InChI:InChI=1S/C36H30O16/c37-20-6-1-16(11-24(20)41)13-27(34(45)46)50-29(44)10-5-18-3-9-23(40)33-30(18)31(32(52-33)19-4-8-22(39)26(43)15-19)36(49)51-28(35(47)48)14-17-2-7-21(38)25(42)12-17/h1-12,15,27-28,31-32,37-43H,13-14H2,(H,45,46)(H,47,48)/b10-5+/t27-,28-,31+,32-/m1/s1
InChI key:InChIKey=SNKFFCBZYFGCQN-VWUOOIFGSA-N
SMILES:C(O[C@H](CC1=CC(O)=C(O)C=C1)C(O)=O)(=O)[C@H]2C=3C(O[C@@H]2C4=CC(O)=C(O)C=C4)=C(O)C=CC3/C=C/C(O[C@H](CC5=CC(O)=C(O)C=C5)C(O)=O)=O
Synonyms:- (2R)-2-({(2E)-3-[(2S,3S)-3-{[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl}-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl}oxy)-3-(3,4-dihydroxyphenyl)propanoic acid
- (2R)-2-({(2E)-3-[(2S,3S)-3-{[1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl}-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl}oxy)-3-(3,4-dihydroxyphenyl)propanoic acid
- 3-(1-Carboxy-2-(3,4-dihydroxyphenyl)ethyl) 4-(3-(1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy)-3-oxo-1-propenyl)-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-3-benzofurancarboxylate (2S-(2alpha,3beta(S*),4(E(S*))))-
- 3-Benzofurancarboxylic acid, 4-(3-(1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy)-3-oxo-1-propenyl)-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-(1-carboxy-2-(3,4-dihydroxyphenyl)ethyl) ester, (2S-(2alpha,3beta(S*),4(E(S*))))-
- 3-Benzofurancarboxylic acid, 4-[(1E)-3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-3-oxo-1-propen-1-yl]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethyl] ester, (2S,3S)-
- 3-Benzofurancarboxylic acid, 4-[(1E)-3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-3-oxo-1-propenyl]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethyl] ester, (2S,3S)-
- 3-Benzofurancarboxylic acid, 4-[3-[1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-3-oxo-1-propenyl]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl] ester, [2S-[2α,3β(S*),4[E(S*)]]]-
- Dan Shen Suan B
- Danfensuan B
- Lithospermate B
- Salvianolate
- Salvianolic acid B
- Zinc 49538628
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Salvianolic acid B
CAS:Salvianolic acid B analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C36H30O16Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:718.63Salvianolic Acid B
CAS:Other glycosides, natural or reproduced by synthesis, aFormula:C36H30O16Color and Shape:PowderMolecular weight:718.15338Salvianolic Acid B
CAS:Formula:C36H30O16Purity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:718.62Salvianolic acid B
CAS:Formula:C36H30O16Purity:≥ 95.0%Color and Shape:White to off-white powder or solidMolecular weight:718.62Salvianolic acid b
CAS:Oxygen-heterocyclic compoundFormula:C36H30O16Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:718.63Salvianolic Acid B
CAS:Controlled Product<p>Applications Salvianolic acid A (Sal A) and salvianolic acid B (Sal B) were isolated and purified from the crude extract of Salvia miltiorrhiza. Antioxidant activities of Sal A and Sal B were also evaluated and the ABTS results showed that Sal A and Sal B exhibited high total antioxidant activities, their EC50 values were 1.35 0.00 and 1.43 0.01 .mu.g/mL. This compound always contains a significant amount of residual solvent.<br>References Lin, T., et al.: Biochem. Pharmacol., 51, 1237 (1996), Abd-Elazem, I., et al.: Antivir. Res., 55, 91 (2002), Ji, X., et al.: Life Sci., 73, 1413 (2003), Lin, Y., et al.: Biochem. Biophys. Res. Commun., 348, 593 (2006),<br></p>Formula:C36H30O16Color and Shape:NeatMolecular weight:718.61Salvianolic acid B
CAS:<p>Salvianolic acid B is a polyphenolic compound, which is derived from the root of Salvia miltiorrhiza, commonly known as Danshen. It is characterized by its potent antioxidant properties, which function primarily through the scavenging of free radicals and inhibition of lipid peroxidation. The compound contributes to the stabilization of endothelial cells and the prevention of atherosclerosis by modulating various signaling pathways involved in oxidative stress and inflammation.</p>Formula:C36H30O16Purity:Min. 98 Area-%Color and Shape:Slightly Yellow PowderMolecular weight:718.61 g/molSalvianolic acid B
CAS:<p>Salvianolic acid B (Dan Shen Suan B) is a water-soluble antioxidant from Salvia miltiorrhiza extract with antiplatelet aggregation and antithrombotic effects.</p>Formula:C36H30O16Purity:99.75% - 99.86%Color and Shape:Yellow SolidMolecular weight:718.61











