CAS 1215295-83-2
:2-Amino-N-methyl-5-pyrimidinemethanamine
Description:
2-Amino-N-methyl-5-pyrimidinemethanamine, identified by its CAS number 1215295-83-2, is a chemical compound that features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound possesses amino groups that contribute to its basicity and potential reactivity. The presence of the N-methyl group indicates that one of the amino groups is substituted with a methyl group, which can influence the compound's solubility and biological activity. Typically, compounds of this nature may exhibit properties such as being soluble in polar solvents due to the presence of amino groups, and they may participate in hydrogen bonding. The structural characteristics suggest potential applications in pharmaceuticals or as intermediates in organic synthesis, particularly in the development of biologically active molecules. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C6H10N4
InChI:InChI=1S/C6H10N4/c1-8-2-5-3-9-6(7)10-4-5/h3-4,8H,2H2,1H3,(H2,7,9,10)
InChI key:InChIKey=SAYIDBFKZNLZDN-UHFFFAOYSA-N
SMILES:C(NC)C=1C=NC(N)=NC1
Synonyms:- 2-Amino-N-methyl-5-pyrimidinemethanamine
- 5-Pyrimidinemethanamine, 2-amino-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
