CAS 1215295-93-4

1H-Indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-1-methyl-5-oxo-

Description:

1H-Indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-1-methyl-5-oxo- is a heterocyclic organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the tetrahydro structure indicates that the compound has a saturated ring system, which can influence its physical properties, such as solubility and boiling point. The methyl and keto groups enhance its chemical reactivity and may participate in various chemical reactions, including condensation and substitution. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, the unique combination of functional groups and ring structures in this compound suggests potential applications in pharmaceuticals or agrochemicals.

Formula: C₉H₁₀N₂O₃

InChI: InChI=1S/C9H10N2O3/c1-11-7-3-2-5(12)4-6(7)8(10-11)9(13)14/h2-4H2,1H3,(H,13,14)

InChI key: InChIKey=BMCJAUHTKKJQCP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N(C)N1)CCC(=O)C2

Synonyms:

• 1-Methyl-5-oxo-6,7-dihydro-4H-indazole-3-carboxylic acid
• 1H-Indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-1-methyl-5-oxo-