CAS 1215295-99-0
:Methyl 4-formyl-1H-pyrazole-1-propanoate
Description:
Methyl 4-formyl-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a formyl group (-CHO) and a methyl ester group (-COOCH3) attached to the pyrazole, contributing to its reactivity and potential applications in organic synthesis. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and nucleophilic addition, making it useful in the synthesis of more complex molecules. Additionally, the ester functionality may enhance its solubility in organic solvents, facilitating its use in various chemical reactions. Methyl 4-formyl-1H-pyrazole-1-propanoate may also exhibit biological activity, which could be of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and could vary based on purity and environmental conditions. Overall, this compound represents a versatile building block in organic chemistry.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-13-8(12)2-3-10-5-7(6-11)4-9-10/h4-6H,2-3H2,1H3
InChI key:InChIKey=VXSYKQAXEHHTDO-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)N1C=C(C=O)C=N1
Synonyms:- 1H-Pyrazole-1-propanoic acid, 4-formyl-, methyl ester
- Methyl 4-formyl-1H-pyrazole-1-propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl 3-(4-formyl-1H-pyrazol-1-yl)propanoate
CAS:Methyl 3-(4-formyl-1H-pyrazol-1-yl)propanoate is a fine chemical that is used as a building block for the production of other compounds. It is also used in research and development to produce novel compounds. The compound has been shown to be a versatile scaffold for the synthesis of new materials. Methyl 3-(4-formyl-1H-pyrazol-1-yl)propanoate is an intermediate in the production of reagents and speciality chemicals, such as pharmaceuticals, pesticides, and active ingredients for fragrances. This compound has a CAS number of 1215295-99-0 and can be found under the name "Methyl 3-(4-formyl-1H pyrazol 1 yl)propanoate" on Chemical Abstracts Service (CAS).Formula:C8H10N2O3Purity:(¹H-Nmr) Min. 95 Area-%Color and Shape:PowderMolecular weight:182.18 g/mol
