CymitQuimica logo

CAS 121536-25-2

:

Poly(pyrrole-3-carboxylic acid)

Description:
Poly(pyrrole-3-carboxylic acid) is a conducting polymer derived from pyrrole, characterized by its carboxylic acid functional groups that enhance its solubility and processability. This polymer exhibits unique electrical conductivity, which can be attributed to the conjugated π-electron system formed during polymerization. The presence of carboxylic acid groups not only contributes to its solubility in polar solvents but also allows for potential interactions with various ions and biomolecules, making it suitable for applications in sensors, drug delivery, and bioelectronics. Additionally, poly(pyrrole-3-carboxylic acid) can undergo various chemical modifications to tailor its properties for specific applications. Its stability and environmental resistance are notable, which further enhances its utility in diverse fields, including environmental remediation and energy storage. The polymer's synthesis typically involves oxidative polymerization, and its properties can be influenced by factors such as the polymerization conditions and the presence of dopants. Overall, poly(pyrrole-3-carboxylic acid) represents a versatile material with promising applications in advanced technologies.
Formula:(C5H5NO2)x
InChI:InChI=1S/C5H5NO2/c7-5(8)4-1-2-6-3-4/h1-3,6H,(H,7,8)
InChI key:InChIKey=DOYOPBSXEIZLRE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CNC1
Synonyms:
  • Poly(pyrrole-3-carboxylic acid)
  • Pyrrole-3-carboxylic acid homopolymer
  • 1H-Pyrrole-3-carboxylic acid, homopolymer
  • 3-Carboxypyrrole homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.