CymitQuimica logo

CAS 1215368-15-2

:

3-(methylsulfonyl)pyrrolidine hydrochloride

Description:
3-(Methylsulfonyl)pyrrolidine hydrochloride is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a methylsulfonyl group enhances its solubility in polar solvents and may influence its biological activity. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that may interact with biological targets. The hydrochloride form indicates that it is a protonated species, which can affect its pharmacokinetics and bioavailability. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions under which it is synthesized or stored. Overall, 3-(methylsulfonyl)pyrrolidine hydrochloride represents a versatile building block in organic synthesis and drug development.
Formula:C5H11NO2SHCL
InChI:InChI=1S/C5H11NO2S.ClH/c1-9(7,8)5-2-3-6-4-5;/h5-6H,2-4H2,1H3;1H
InChI key:LRCGEDCMPFJUSI-UHFFFAOYSA-N
SMILES:CS(=O)(=O)C1CCNC1.Cl
Synonyms:
  • Pyrrolidine, 3-(methylsulfonyl)-, hydrochloride
  • (RS)-3-(Methylsulfonyl)-pyrrolidine HCl
  • (RS)-3-(Methylsulfonyl)-pyrrolidine Hydrochloride
Found 3 products.