CAS 121537-94-8
:2-AMINO-PYRROLIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
Description:
2-Amino-pyrrolidine-1-carboxylic acid tert-butyl ester, with the CAS number 121537-94-8, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an amino group and a carboxylic acid moiety, with the latter being esterified with a tert-butyl group, enhancing its lipophilicity and stability. It is typically a white to off-white solid and is soluble in organic solvents, making it useful in various synthetic applications. The presence of the amino group allows for potential reactivity in further chemical transformations, such as peptide synthesis or as a building block in drug development. Its tert-butyl ester form can also influence its pharmacokinetic properties, such as absorption and metabolism. Overall, this compound is of interest in medicinal chemistry and may serve as an intermediate in the synthesis of biologically active molecules.
Formula:C9H18N2O2
InChI:InChI=1/C9H18N2O2/c1-9(2,3)13-8(12)11-6-4-5-7(11)10/h7H,4-6,10H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCCC1N
Synonyms:- 1-Pyrrolidinecarboxylic Acid, 2-Amino-, 1,1-Dimethylethyl Ester
- 2-Methyl-2-propanyl 2-amino-1-pyrrolidinecarboxylate
- tert-Butyl 2-aminopyrrolidine-1-carboxylate
- tert-Butyl-2-aminopyrrolidin-1-carboxylat
- 2-Amino-pyrrolidine-1-carboxylic acid tert-butyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
