
CAS 121545-81-1
:4-Amino-2,3-dihydro-1H-indol-7-ol
Description:
4-Amino-2,3-dihydro-1H-indol-7-ol, with the CAS number 121545-81-1, is an organic compound characterized by its indole structure, which features a fused benzene and pyrrole ring. This compound contains an amino group (-NH2) and a hydroxyl group (-OH) attached to the indole framework, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anticancer properties. Its molecular structure allows for various interactions with biological targets, making it a subject of study in drug design. Additionally, the presence of both amino and hydroxyl functional groups suggests that it may participate in hydrogen bonding, influencing its physical properties and reactivity.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c9-6-1-2-7(11)8-5(6)3-4-10-8/h1-2,10-11H,3-4,9H2
InChI key:InChIKey=OCHAQTCASLOPQY-UHFFFAOYSA-N
SMILES:NC1=C2C(=C(O)C=C1)NCC2
Synonyms:- 4-Amino-7-hydroxyindoline
- 1H-Indol-7-ol, 4-amino-2,3-dihydro-
- 4-Amino-2,3-dihydro-1H-indol-7-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.