CymitQuimica logo

CAS 1215484-85-7

:

1,2,4,5,6,7-Hexahydro-2-phenyl-3H-pyrazolo[3,4-c]pyridin-3-one

Description:
1,2,4,5,6,7-Hexahydro-2-phenyl-3H-pyrazolo[3,4-c]pyridin-3-one is a heterocyclic compound characterized by its complex bicyclic structure, which includes both a pyrazole and a pyridine moiety. This compound features a phenyl group, contributing to its aromatic characteristics and potential for various chemical interactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of multiple rings and functional groups suggests that it may participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions. Its unique structure may also impart interesting biological activities, making it a candidate for pharmaceutical research. The compound's CAS number, 1215484-85-7, allows for precise identification in chemical databases, facilitating further studies on its properties and potential applications in medicinal chemistry or material science. As with many heterocycles, the stability and reactivity of this compound can be influenced by substituents and environmental conditions.
Formula:C12H13N3O
InChI:InChI=1S/C12H13N3O/c16-12-10-6-7-13-8-11(10)14-15(12)9-4-2-1-3-5-9/h1-5,13-14H,6-8H2
InChI key:InChIKey=CXSJTBAKSSSZJL-UHFFFAOYSA-N
SMILES:O=C1N(NC2=C1CCNC2)C3=CC=CC=C3
Synonyms:
  • 3H-Pyrazolo[3,4-c]pyridin-3-one, 1,2,4,5,6,7-hexahydro-2-phenyl-
  • 1,2,4,5,6,7-Hexahydro-2-phenyl-3H-pyrazolo[3,4-c]pyridin-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.