CymitQuimica logo

CAS 121554-09-4

:

4-(N-octyloxy)benzeneboronic acid

Description:
4-(N-octyloxy)benzeneboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a benzene ring that is further substituted with an octyloxy group. This compound typically exhibits properties associated with both boronic acids and alkoxy-substituted aromatic compounds. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The octyloxy substituent enhances the compound's solubility in organic solvents and can influence its physical properties, such as melting point and boiling point. Additionally, the presence of the long hydrophobic octyl chain may impart amphiphilic characteristics, allowing for interactions with both polar and nonpolar environments. This compound may also exhibit interesting electronic properties due to the conjugation between the boronic acid and the aromatic system, making it a candidate for applications in organic electronics and sensor technologies. Overall, 4-(N-octyloxy)benzeneboronic acid is a versatile compound with potential utility in various chemical and material science fields.
Formula:C14H23BO3
InChI:InChI=1S/C14H23BO3/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17/h8-11,16-17H,2-7,12H2,1H3
InChI key:WABZSVITXOJJKH-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)OCCCCCCCC)(O)O
Synonyms:
  • 4-(N-octyloxy)phenylboronic acid
  • 4-Octyloxyphenylboronic Acid
  • Akos Brn-0173
  • 4-n-Octyloxybenzeneboronic acid
Found 5 products.