CymitQuimica logo

CAS 121559-53-3

:

Poly(oxy-1,2-ethanediyl), α-[(2,2,2-trifluoroethyl)sulfonyl]-ω-methoxy-

Description:
Poly(oxy-1,2-ethanediyl), α-[(2,2,2-trifluoroethyl)sulfonyl]-ω-methoxy- is a synthetic polymer characterized by its unique structure that incorporates both polyether and sulfonyl functionalities. This compound features a poly(ethylene glycol) backbone, which contributes to its hydrophilicity and solubility in various solvents. The presence of the trifluoroethyl sulfonyl group enhances its chemical stability and introduces fluorinated characteristics, which can improve its performance in specific applications, such as in surfactants or as a dispersant. The methoxy terminal group provides additional functionalization, allowing for potential interactions with other chemical species. This polymer is typically utilized in fields such as materials science, pharmaceuticals, and chemical engineering, where its properties can be leveraged for applications requiring specific surface activity or solubility profiles. Overall, its unique combination of hydrophilic and hydrophobic segments makes it a versatile compound in various industrial and research applications.
Formula:(C2H4O)nC3H5F3O3S
InChI:InChI=1S/C5H9F3O4S/c1-11-2-3-12-13(9,10)4-5(6,7)8/h2-4H2,1H3
InChI key:InChIKey=DISXNVGIQYXZRE-UHFFFAOYSA-N
SMILES:COCCOS(=O)(=O)CC(F)(F)F
Synonyms:
  • 2-Methoxyethyl 2,2,2-Trifluoroethanesulfonate
  • Methoxypolyethylene glycol 5,000 trifluoroethanesulfonate
  • Poly(oxy-1,2-ethanediyl), α-[(2,2,2-trifluoroethyl)sulfonyl]-ω-methoxy-
  • Tresyl monomethoxy polyethylene glycol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.