CymitQuimica logo

CAS 1215597-17-3

:

2-Amino-5-bromo-4-hydroxypyrimidinehydrobromide

Description:
2-Amino-5-bromo-4-hydroxypyrimidine hydrobromide is a chemical compound characterized by its pyrimidine ring structure, which includes amino and hydroxyl functional groups, as well as a bromine substituent. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the hydrobromide salt form, which enhances its solubility. The amino group contributes to its basicity, while the hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The bromine atom introduces a halogen, which can affect the compound's electronic properties and reactivity, making it useful in various chemical syntheses and biological applications. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its potential biological activity. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.
Formula:C4H5Br2N3O
InChI:InChI=1S/C4H4BrN3O.BrH/c5-2-1-7-4(6)8-3(2)9;/h1H,(H3,6,7,8,9);1H
InChI key:FBEVHQMVCKKOOY-UHFFFAOYSA-N
SMILES:C1=C(C(=O)NC(=N1)N)Br.Br
Found 3 products.