CymitQuimica logo

CAS 121562-13-8

:

3-BROMO-5-BROMOMETHYL-[1,2,4]OXADIAZOLE

Description:
3-Bromo-5-bromomethyl-[1,2,4]oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. The presence of bromine substituents at the 3 and 5 positions enhances its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential use in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the oxadiazole moiety, which is known for its biological activity. Additionally, the bromine atoms can facilitate further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3-bromo-5-bromomethyl-[1,2,4]oxadiazole is a compound of interest for researchers in both synthetic and medicinal chemistry fields.
Formula:C3H2Br2N2O
InChI:InChI=1S/C3H2Br2N2O/c4-1-2-6-3(5)7-8-2/h1H2
InChI key:TWKMZSDPRBTXPI-UHFFFAOYSA-N
SMILES:C(C1=NC(=NO1)Br)Br
Found 3 products.