CAS 121563-65-3

5-(2-iodovinyl)-1-(2'-fluoro-2'-deoxyuridine)

Description:

5-(2-Iodovinyl)-1-(2'-fluoro-2'-deoxyuridine) is a synthetic nucleoside analog that incorporates both iodine and fluorine substituents, which can influence its biological activity and stability. This compound is characterized by its structural modifications that enhance its potential as an antiviral agent, particularly against viral infections such as HIV. The presence of the iodovinyl group is significant as it can facilitate interactions with viral enzymes, while the fluorine atom may improve the compound's metabolic stability and cellular uptake. The compound's mechanism of action typically involves interference with nucleic acid synthesis, thereby inhibiting viral replication. Additionally, its unique chemical structure allows for potential applications in medicinal chemistry and drug development. As with many nucleoside analogs, the pharmacokinetics, toxicity, and efficacy of this compound are critical factors that are studied in preclinical and clinical settings to assess its therapeutic potential. Overall, 5-(2-iodovinyl)-1-(2'-fluoro-2'-deoxyuridine) represents a noteworthy example of how structural modifications can lead to enhanced biological activity in antiviral therapies.

Formula: C₁₁H₁₂FIN₂O₅

InChI: InChI=1/C11H12FIN2O5/c12-7-8(17)6(4-16)20-10(7)15-3-5(1-2-13)9(18)14-11(15)19/h1-3,6-8,10,16-17H,4H2,(H,14,18,19)/b2-1+/t6-,7+,8-,10-/m1/s1

Synonyms:

• 5-(2-Iodovinyl)-1-(2-deoxy-2-fluoro-D-ribofuranosyl)uracil
• Ivfru
• Uridine, 2'-deoxy-2'-fluoro-5-(2-iodoethyenyl)-, (E)-
• 1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-[(E)-2-iodoethenyl]pyrimidine-2,4(1H,3H)-dione
• 5-(2-Iodovinyl)-1-(2'-fluoro-2'-deoxyuridine)