CymitQuimica logo

CAS 1215672-25-5

:

N-Methyl-4-(1-pyrrolidinyl)tetrahydro-3-furanamine

Description:
N-Methyl-4-(1-pyrrolidinyl)tetrahydro-3-furanamine, identified by its CAS number 1215672-25-5, is a chemical compound that belongs to the class of amines and is characterized by its unique structural features. It contains a tetrahydrofuran ring fused with a pyrrolidine moiety, contributing to its potential biological activity. The presence of the N-methyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in neuropharmacology, as it may interact with neurotransmitter systems. Its molecular structure suggests it could exhibit properties such as moderate solubility in organic solvents and possible reactivity with electrophiles due to the amine functional group. Additionally, the stereochemistry of the compound may play a crucial role in its biological interactions. As with many synthetic compounds, safety and handling precautions are essential, as the specific toxicity and environmental impact of this substance would need to be evaluated through further research.
Formula:C9H18N2O
InChI:InChI=1S/C9H18N2O/c1-10-8-6-12-7-9(8)11-4-2-3-5-11/h8-10H,2-7H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.