CymitQuimica logo

CAS 1215767-72-8

:

5-Bromo-8-fluoro-2-methoxyquinoline

Description:
5-Bromo-8-fluoro-2-methoxyquinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of bromine and fluorine substituents at the 5 and 8 positions, respectively, along with a methoxy group at the 2 position, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. The presence of halogen atoms can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the methoxy group may affect the compound's electronic properties and steric hindrance, which can be crucial for its biological activity. As with many synthetic compounds, safety data and handling precautions should be considered, as they may pose risks if not managed properly.
Formula:C10H7BrFNO
InChI:InChI=1S/C10H7BrFNO/c1-14-9-5-2-6-7(11)3-4-8(12)10(6)13-9/h2-5H,1H3
InChI key:InChIKey=HXISJRODSBCOHY-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=C(OC)C=C2)C(F)=CC1
Synonyms:
  • 5-Bromo-8-fluoro-2-methoxyquinoline
  • Quinoline, 5-bromo-8-fluoro-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.