CymitQuimica logo

CAS 1215767-85-3

:

5-Bromo-7-chloro-8-quinolinamine

Description:
5-Bromo-7-chloro-8-quinolinamine is a chemical compound characterized by its heterocyclic structure, which includes a quinoline moiety. This compound features both bromine and chlorine substituents, which can influence its reactivity and biological activity. The presence of the amino group (-NH2) at the 8-position of the quinoline ring enhances its potential for hydrogen bonding and can contribute to its solubility in polar solvents. The bromine and chlorine atoms introduce halogen functionalities that may affect the compound's electronic properties and steric hindrance, potentially impacting its interactions with biological targets. 5-Bromo-7-chloro-8-quinolinamine may exhibit antimicrobial or antitumor activities, making it of interest in medicinal chemistry. Its synthesis typically involves halogenation and amination reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure. As with many quinoline derivatives, the compound's properties may be influenced by the specific arrangement of substituents, making it a subject of study for various applications in pharmaceuticals and agrochemicals.
Formula:C9H6BrClN2
InChI:InChI=1S/C9H6BrClN2/c10-6-4-7(11)8(12)9-5(6)2-1-3-13-9/h1-4H,12H2
InChI key:InChIKey=KXURWWAXSORLJY-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(Br)=CC1Cl)C=CC=N2
Synonyms:
  • 5-Bromo-7-chloro-8-quinolinamine
  • 8-Quinolinamine, 5-bromo-7-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.