CAS 1215767-98-8

5-Bromo-1-methoxy-3-methylisoquinoline

Description:

5-Bromo-1-methoxy-3-methylisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 5-position and a methoxy group at the 1-position contributes to its unique reactivity and potential applications in medicinal chemistry. The methyl group at the 3-position further influences its electronic properties and steric hindrance. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Additionally, the presence of halogen and methoxy functionalities can enhance its reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many isoquinoline derivatives, it may also display interesting fluorescence properties, which can be useful in analytical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₁H₁₀BrNO

InChI: InChI=1S/C11H10BrNO/c1-7-6-9-8(11(13-7)14-2)4-3-5-10(9)12/h3-6H,1-2H3

InChI key: InChIKey=CBBDJWDPFQJBGM-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=C(C)N1)C(Br)=CC=C2

Synonyms:

• Isoquinoline, 5-bromo-1-methoxy-3-methyl-
• 5-Bromo-1-methoxy-3-methylisoquinoline