
CAS 121577-32-0
:Gatifloxacinacid
Description:
Gatifloxacinacid, with the CAS number 121577-32-0, is a chemical compound that is a derivative of gatifloxacin, which is a fluoroquinolone antibiotic. This substance is characterized by its ability to inhibit bacterial DNA gyrase and topoisomerase IV, enzymes critical for bacterial DNA replication and transcription. Gatifloxacinacid is typically used in the treatment of various bacterial infections, particularly those affecting the respiratory tract and urinary system. The compound exhibits broad-spectrum antibacterial activity, making it effective against both Gram-positive and Gram-negative bacteria. In terms of its physical properties, gatifloxacinacid is generally soluble in water and exhibits moderate stability under standard conditions. Its pharmacological profile includes potential side effects, which may include gastrointestinal disturbances and central nervous system effects. As with other fluoroquinolones, caution is advised in its use, particularly in populations with specific contraindications, such as those with a history of tendon disorders or certain neurological conditions.
Formula:C19H23ClFN3O4
InChI:InChI=1S/C19H22FN3O4.ClH/c1-10-8-22(6-5-21-10)16-14(20)7-12-15(18(16)27-2)23(11-3-4-11)9-13(17(12)24)19(25)26;/h7,9-11,21H,3-6,8H2,1-2H3,(H,25,26);1H
InChI key:GQYBNVXJQVIRGC-UHFFFAOYSA-N
SMILES:CC1CN(CCN1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
1-Cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride
CAS:Formula:C19H23ClFN3O4Purity:98%Color and Shape:SolidMolecular weight:411.8550Gatifloxacin hydrochloride
CAS:Gatifloxacin hydrochlorideFormula:C19H23ClFN3O4Purity:≥98%Molecular weight:411.86Gatifloxacin HCl
CAS:1-Cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochlorideFormula:C19H23ClFN3O4Purity:98%Molecular weight:411.86Gatifloxacin hydrochloride
CAS:Gatifloxacin hydrochloride, a fourth-gen fluoroquinolone antibiotic, blocks bacterial DNA rotase and topoisomerase IV.Formula:C19H23ClFN3O4Purity:99.85% - 99.89%Color and Shape:SolidMolecular weight:411.861-Cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride
CAS:Purity:98%Molecular weight:411.8599854Gatifloxacin hydrochloride
CAS:Gatifloxacin hydrochloride is a fluoroquinolone antibiotic, which is synthesized chemically from quinolone compounds. It exhibits its mode of action by inhibiting bacterial DNA gyrase and topoisomerase IV, essential enzymes responsible for DNA replication and transcription processes in bacteria. This disruption of DNA processes leads to bacterial cell death, making it effective against a wide range of Gram-positive and Gram-negative bacteria.Formula:C19H23ClFN3O4Purity:Min. 95%Molecular weight:411.86 g/mol






