CymitQuimica logo

CAS 121577-35-3

:

Ethyl α-[(dimethylamino)methylene]-2,4,5-trifluoro-3-methoxy-β-oxobenzenepropanoate

Description:
Ethyl α-[(dimethylamino)methylene]-2,4,5-trifluoro-3-methoxy-β-oxobenzenepropanoate, identified by its CAS number 121577-35-3, is a synthetic organic compound characterized by its complex structure, which includes a trifluoromethyl group, a methoxy group, and a dimethylamino moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups that can participate in various chemical reactions. The trifluoromethyl group often imparts unique electronic properties, enhancing lipophilicity and influencing biological activity. The methoxy group can affect the compound's polarity and reactivity, while the dimethylamino group may contribute to basicity and potential interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential applications in drug development or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C15H16F3NO4
InChI:InChI=1S/C15H16F3NO4/c1-5-23-15(21)9(7-19(2)3)13(20)8-6-10(16)12(18)14(22-4)11(8)17/h6-7H,5H2,1-4H3
InChI key:InChIKey=SDERJCOTKYHVKX-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)=CN(C)C)(=O)C1=C(F)C(OC)=C(F)C(F)=C1
Synonyms:
  • Benzenepropanoic acid, α-[(dimethylamino)methylene]-2,4,5-trifluoro-3-methoxy-β-oxo-, ethyl ester
  • Ethyl α-[(dimethylamino)methylene]-2,4,5-trifluoro-3-methoxy-β-oxobenzenepropanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.