CAS 121578-11-8

nonane-D20

Description:

Nonane-D20, with the CAS number 121578-11-8, is a deuterated form of nonane, a straight-chain alkane consisting of nine carbon atoms. The "D20" designation indicates that this compound contains deuterium, a stable isotope of hydrogen, which replaces some of the hydrogen atoms in the nonane molecule. This substitution alters the physical and chemical properties of the compound, making it useful in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques where isotopic labeling is beneficial. Nonane-D20 is typically a colorless liquid at room temperature and exhibits similar characteristics to nonane, such as hydrophobicity and low reactivity. Its density and boiling point may differ slightly from those of nonane due to the presence of deuterium. The use of deuterated solvents like nonane-D20 is crucial in studies involving molecular dynamics and interactions, as they provide a clearer understanding of molecular behavior without interfering with the signals of interest in spectroscopic analyses.

Formula: C₉D₂₀

InChI: InChI=1/C9H20/c1-3-5-7-9-8-6-4-2/h3-9H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2

SMILES: C(C(C(C(C(C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• (2H20)nonane

n-Nonane-d20

CAS: 121578-11-8

Formula: CD₃(CD₂)₇CD₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 148.28204

Ref: 3U-D5054

n-Nonane-d20

Controlled Product

CAS: 121578-11-8

Applications n-Nonane-d20 (CAS# 121578-11-8) is a useful isotopically labeled research compound.

Formula: C₉D₂₀

Color and Shape: Neat

Molecular weight: 148.38

Ref: TR-N211121