
CAS 121582-53-4
:Methyl 1,6-dihydro-4-hydroxy-6-oxo-1-phenyl-3-pyridazinecarboxylate
Description:
Methyl 1,6-dihydro-4-hydroxy-6-oxo-1-phenyl-3-pyridazinecarboxylate, identified by its CAS number 121582-53-4, is a chemical compound that belongs to the class of pyridazine derivatives. This substance typically exhibits a complex molecular structure characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of functional groups such as a hydroxyl group and a carbonyl group contributes to its reactivity and potential applications in organic synthesis. The methyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, Methyl 1,6-dihydro-4-hydroxy-6-oxo-1-phenyl-3-pyridazinecarboxylate represents a unique structure with potential applications in various fields of chemistry.
Formula:C12H10N2O4
InChI:InChI=1S/C12H10N2O4/c1-18-12(17)11-9(15)7-10(16)14(13-11)8-5-3-2-4-6-8/h2-7,15H,1H3
InChI key:InChIKey=PKKHFXIPQXUWGN-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C(OC)=O)C(O)=C1)C2=CC=CC=C2
Synonyms:- 3-Pyridazinecarboxylic acid, 1,6-dihydro-4-hydroxy-6-oxo-1-phenyl-, methyl ester
- Methyl 4-hydroxy-6-oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylate
- 4-Hydroxy-6-oxo-1-phenyl-1,6-dihydropyridazine-3-carboxylic acid methyl ester
- Methyl 1,6-dihydro-4-hydroxy-6-oxo-1-phenyl-3-pyridazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.