CAS 1215850-33-1

3-Chloro-6-(4-thiazolylmethoxy)pyridazine

Description:

3-Chloro-6-(4-thiazolylmethoxy)pyridazine is a chemical compound characterized by its unique structural features, which include a pyridazine ring substituted with a chlorine atom and a thiazole-derived methoxy group. The presence of the chlorine atom at the 3-position contributes to its reactivity and potential biological activity. The thiazole moiety, known for its role in various pharmacological applications, enhances the compound's properties, potentially influencing its solubility and interaction with biological targets. This compound may exhibit specific characteristics such as moderate to high polarity due to the presence of the methoxy group, which can affect its bioavailability and interaction with cellular systems. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed through various analytical methods. Overall, 3-Chloro-6-(4-thiazolylmethoxy)pyridazine represents a compound of interest for further research in chemical and biological fields.

Formula: C₈H₆ClN₃OS

InChI: InChI=1S/C8H6ClN3OS/c9-7-1-2-8(12-11-7)13-3-6-4-14-5-10-6/h1-2,4-5H,3H2

InChI key: InChIKey=RHTSIZIMKYZPET-UHFFFAOYSA-N

SMILES: O(CC1=CSC=N1)C2=CC=C(Cl)N=N2

Synonyms:

• Pyridazine, 3-chloro-6-(4-thiazolylmethoxy)-
• 3-Chloro-6-(4-thiazolylmethoxy)pyridazine
• 3-Chloro-6-[(1,3-thiazol-4-yl)methoxy]pyridazine
• 3-Chloro-6-((thiazol-4-yl)methoxy)pyridazine