CAS 121604-60-2

3-Cyclobutyl-5-isoxazolecarboxaldehyde

Description:

3-Cyclobutyl-5-isoxazolecarboxaldehyde is an organic compound characterized by its unique structural features, which include a cyclobutyl group and an isoxazole ring. The isoxazole moiety contributes to its potential reactivity, particularly in electrophilic reactions due to the presence of the carbonyl group in the aldehyde functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various synthetic applications, particularly in the field of medicinal chemistry and organic synthesis. The presence of the cyclobutyl group may impart distinctive steric and electronic properties, influencing its reactivity and interactions with biological targets. Additionally, compounds like 3-Cyclobutyl-5-isoxazolecarboxaldehyde may exhibit interesting biological activities, making them candidates for further research in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₉NO₂

InChI: InChI=1S/C8H9NO2/c10-5-7-4-8(9-11-7)6-2-1-3-6/h4-6H,1-3H2

InChI key: InChIKey=QYGRFWYIAYZBFX-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=NO1)C2CCC2

Synonyms:

• 5-Isoxazolecarboxaldehyde, 3-cyclobutyl-
• 3-Cyclobutyl-1,2-oxazole-5-carbaldehyde
• 3-Cyclobutylisoxazole-5-carbaldehyde
• 3-Cyclobutyl-5-isoxazolecarboxaldehyde