CAS 121609-45-8

3-Ethylcyclobutaneacetic acid

Description:

3-Ethylcyclobutaneacetic acid is an organic compound characterized by its cyclobutane ring structure with an ethyl group and an acetic acid functional group. This compound features a four-membered carbon ring, which contributes to its unique strain and reactivity. The presence of the ethyl substituent introduces additional branching, influencing its physical properties such as boiling and melting points, as well as its solubility in various solvents. The acetic acid moiety provides acidic characteristics, allowing for potential interactions in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in organic synthesis and as a building block in pharmaceuticals or agrochemicals. The compound's specific reactivity and stability can be influenced by factors such as temperature and the presence of other functional groups. As with many organic acids, it may exhibit behavior typical of carboxylic acids, including the ability to donate protons in solution. Overall, 3-Ethylcyclobutaneacetic acid is a compound of interest in the field of organic chemistry due to its unique structural features and potential applications.

Formula: C₈H₁₄O₂

InChI: InChI=1S/C8H14O2/c1-2-6-3-7(4-6)5-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)

InChI key: InChIKey=SAWFSRMTDRNBDR-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1CC(CC)C1

Synonyms:

• 3-Ethylcyclobutaneacetic acid
• (3-Ethylcyclobutyl)acetic acid
• 2-(3-Ethylcyclobutyl)acetic acid
• Cyclobutaneacetic acid, 3-ethyl-