CAS 121634-34-2
:coumamidine gamma2
Description:
Coumamidine gamma2, with the CAS number 121634-34-2, is a chemical compound that belongs to the class of coumarin derivatives. It is characterized by its unique structural features, which include a coumarin backbone that is typically associated with various biological activities. This compound may exhibit properties such as fluorescence, making it useful in biochemical assays and imaging applications. Coumamidine gamma2 is often studied for its potential pharmacological effects, including antimicrobial and anti-inflammatory activities. Its solubility and stability in various solvents can vary, influencing its application in research and industry. Additionally, the compound's reactivity may allow for further derivatization, expanding its utility in synthetic chemistry. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, coumamidine gamma2 represents a significant interest in both academic and pharmaceutical research due to its diverse properties and potential applications.
Formula:C33H49N13O13
InChI:InChI=1/C33H49N13O13/c1-12-19(25(49)23(41-29(36)37)28(56-12)57-14-5-2-13(3-6-14)4-7-18(47)40-9-8-17(34)35)44-32(52)46-26-22(43-31(39)51)24(48)16(11-54-26)58-15-10-55-27-21(45-33(53)59-27)20(15)42-30(38)50/h2-7,12,15-16,19-28,48-49H,8-11H2,1H3,(H3,34,35)(H,40,47)(H,45,53)(H4,36,37,41)(H3,38,42,50)(H3,39,43,51)(H2,44,46,52)/b7-4+
Synonyms:- Coumamidine gamma(2)
- Coumamidine gamma2
- (2E)-N-[(3Z)-3-amino-3-iminopropyl]-3-[4-({5-({[3-(carbamoylamino)-5-{[7-(carbamoylamino)-2-oxohexahydro-3aH-pyrano[3,2-d][1,3]oxazol-6-yl]oxy}-4-hydroxytetrahydro-2H-pyran-2-yl]carbamoyl}amino)-3-[(diaminomethylidene)amino]-4-hydroxy-6-methyltetrahydro-2H-pyran-2-yl}oxy)phenyl]prop-2-enamide (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Coumamidine γ2
CAS:<p>Coumamidine γ2 is an alkaline sugar antibiotic with broad-spectrum antimicrobial properties, effective against Pseudomonas aeruginosa.</p>Formula:C33H49N13O13Color and Shape:SolidMolecular weight:835.821
