CymitQuimica logo

CAS 121634-35-3

:

coumamidine gamma1

Description:
Coumamidine gamma1, with the CAS number 121634-35-3, is a chemical compound that belongs to the class of coumarin derivatives. It is characterized by its unique structural features, which include a coumarin backbone that is typically associated with various biological activities. This compound may exhibit properties such as fluorescence, making it useful in various analytical and biological applications. Coumamidine gamma1 is often studied for its potential pharmacological effects, including antimicrobial and anti-inflammatory activities. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and industry. Additionally, the compound's reactivity can be influenced by functional groups present in its structure, allowing for further chemical modifications. Overall, coumamidine gamma1 represents a significant interest in the field of medicinal chemistry and biochemistry due to its diverse potential applications.
Formula:C33H49N13O13
InChI:InChI=1/C33H49N13O13/c1-12-19(25(50)21(41-29(36)37)28(57-12)58-14-5-2-13(3-6-14)4-7-18(47)40-9-8-17(34)35)43-32(53)44-26-20(42-30(38)51)23(48)15(10-55-26)59-16-11-56-27-22(24(16)49)46(31(39)52)33(54)45-27/h2-7,12,15-16,19-28,48-50H,8-11H2,1H3,(H3,34,35)(H2,39,52)(H,40,47)(H,45,54)(H4,36,37,41)(H3,38,42,51)(H2,43,44,53)/b7-4+
Synonyms:
  • Coumamidine gamma(1)
  • 6-{[6-{[(6-{4-[(1E)-3-{[(3Z)-3-amino-3-iminopropyl]amino}-3-oxoprop-1-en-1-yl]phenoxy}-5-[(diaminomethylidene)amino]-4-hydroxy-2-methyltetrahydro-2H-pyran-3-yl)carbamoyl]amino}-5-(carbamoylamino)-4-hydroxytetrahydro-2H-pyran-3-yl]oxy}-7-hydroxy-2-oxohexahydropyrano[2,3-d]imidazole-1(2H)-carboxamide (non-preferred name)
  • Coumamidine gamma1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Coumamidine γ1

    CAS:
    Coumamidine γ1 is an alkaline glycoside antibiotic that exhibits broad-spectrum antibacterial activity, including effectiveness against Pseudomonas aeruginosa.
    Formula:C33H49N13O13
    Color and Shape:Solid
    Molecular weight:835.821

    Ref: TM-TN10565

    10mg
    To inquire
    50mg
    To inquire