CAS 1216665-58-5

4-[[4-[(5-Cyclobutyl-1H-pyrazol-3-yl)amino]-2-quinazolinyl]amino]benzeneacetonitrile

Description:

4-[[4-[(5-Cyclobutyl-1H-pyrazol-3-yl)amino]-2-quinazolinyl]amino]benzeneacetonitrile, identified by its CAS number 1216665-58-5, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and a nitrile functional group. This compound features a quinazoline moiety, which is known for its biological activity, particularly in medicinal chemistry. The presence of the cyclobutyl group and the pyrazole ring suggests potential interactions with biological targets, making it of interest in drug discovery and development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in biological assays. The compound's synthesis typically involves multi-step reactions, and its purity and characterization can be confirmed through techniques such as NMR spectroscopy and mass spectrometry. Overall, this compound represents a class of heterocyclic compounds that may exhibit pharmacological properties, warranting further investigation into its potential therapeutic applications.

Formula: C₂₃H₂₁N₇

InChI: InChI=1S/C23H21N7/c24-13-12-15-8-10-17(11-9-15)25-23-26-19-7-2-1-6-18(19)22(28-23)27-21-14-20(29-30-21)16-4-3-5-16/h1-2,6-11,14,16H,3-5,12H2,(H3,25,26,27,28,29,30)

InChI key: InChIKey=CIPDJGMLNCYWIC-UHFFFAOYSA-N

SMILES: N(C=1C2=C(N=C(NC3=CC=C(CC#N)C=C3)N1)C=CC=C2)C=4C=C(NN4)C5CCC5

Synonyms:

• 4-[[4-[(5-Cyclobutyl-1H-pyrazol-3-yl)amino]-2-quinazolinyl]amino]benzeneacetonitrile
• Benzeneacetonitrile, 4-[[4-[(5-cyclobutyl-1H-pyrazol-3-yl)amino]-2-quinazolinyl]amino]-

ASC-82 (APY82)

CAS: 1216665-58-5

Purity: 98.0%

Molecular weight: 395.47

Ref: 10-F471142