
CAS 1216665-67-6
:4-[[4-[[5-(3-Methyl-2-thienyl)-1H-pyrazol-3-yl]amino]-2-quinazolinyl]amino]benzeneacetonitrile
Description:
The chemical substance known as 4-[[4-[[5-(3-Methyl-2-thienyl)-1H-pyrazol-3-yl]amino]-2-quinazolinyl]amino]benzeneacetonitrile, with the CAS number 1216665-67-6, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a quinazoline moiety, which is known for its biological activity, particularly in medicinal chemistry. The presence of a pyrazole ring and a thienyl group suggests potential applications in pharmaceuticals, possibly as an inhibitor or modulator in biological systems. The compound's structure includes multiple nitrogen atoms, indicating potential for hydrogen bonding and interactions with biological targets. Additionally, the acetonitrile group may contribute to its solubility and reactivity. Overall, this compound's intricate structure and diverse functional groups make it a candidate for further research in drug development and other chemical applications. However, specific properties such as solubility, melting point, and biological activity would require empirical data for comprehensive characterization.
Formula:C24H19N7S
InChI:InChI=1S/C24H19N7S/c1-15-11-13-32-22(15)20-14-21(31-30-20)28-23-18-4-2-3-5-19(18)27-24(29-23)26-17-8-6-16(7-9-17)10-12-25/h2-9,11,13-14H,10H2,1H3,(H3,26,27,28,29,30,31)
InChI key:InChIKey=QGYKWCYQMUSJCI-UHFFFAOYSA-N
SMILES:N(C=1C2=C(N=C(NC3=CC=C(CC#N)C=C3)N1)C=CC=C2)C=4C=C(NN4)C5=C(C)C=CS5
Synonyms:- 4-[[4-[[5-(3-Methyl-2-thienyl)-1H-pyrazol-3-yl]amino]-2-quinazolinyl]amino]benzeneacetonitrile
- Benzeneacetonitrile, 4-[[4-[[5-(3-methyl-2-thienyl)-1H-pyrazol-3-yl]amino]-2-quinazolinyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.