CAS 121670-33-5
:3-(4-methoxyphenyl)propanehydrazide
Description:
3-(4-Methoxyphenyl)propanehydrazide, identified by its CAS number 121670-33-5, is an organic compound characterized by the presence of a hydrazide functional group attached to a propane chain, with a methoxy-substituted phenyl group. This compound typically exhibits properties associated with hydrazides, such as potential reactivity in condensation reactions and the ability to form hydrazones with carbonyl compounds. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. The presence of the aromatic ring can contribute to its stability and may also affect its interaction with biological targets. Additionally, compounds of this nature are often studied for their potential pharmacological properties, including anti-inflammatory and antimicrobial activities. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as hydrazides can be sensitive to heat and may pose health risks.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-14-9-5-2-8(3-6-9)4-7-10(13)12-11/h2-3,5-6H,4,7,11H2,1H3,(H,12,13)
Synonyms:- Benzenepropanoic Acid, 4-Methoxy-, Hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
