CymitQuimica logo

CAS 1216703-05-7

:

6-Iodoimidazo[1,2-b]pyridazine

Description:
6-Iodoimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyridazine moieties. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various interactions, making it a candidate for biological activity, including antimicrobial and anticancer properties. The compound's synthesis often involves multi-step reactions, including halogenation and cyclization processes. Additionally, its stability and reactivity can be influenced by the presence of functional groups and the overall electronic environment of the molecule. As with many heterocycles, 6-Iodoimidazo[1,2-b]pyridazine may also participate in coordination chemistry, potentially forming complexes with metal ions, which could further expand its utility in various chemical applications.
Formula:C6H4IN3
InChI:InChI=1S/C6H4IN3/c7-5-1-2-6-8-3-4-10(6)9-5/h1-4H
InChI key:KKBGGLUVDVJPBO-UHFFFAOYSA-N
SMILES:C1=CC(=NN2C1=NC=C2)I
Found 3 products.