CymitQuimica logo

CAS 121679-30-9

:

4-Hydrazino-N-methtylbenzeneethanesulfonamide

Description:
4-Hydrazino-N-methylbenzeneethanesulfonamide, with the CAS number 121679-30-9, is a chemical compound characterized by its hydrazine functional group and sulfonamide moiety. This compound typically exhibits properties associated with both hydrazines and sulfonamides, including potential reactivity due to the presence of the hydrazino group, which can participate in various chemical reactions such as condensation and oxidation. The sulfonamide group contributes to its solubility in polar solvents and may impart biological activity, as sulfonamides are known for their antimicrobial properties. The presence of the N-methyl group suggests that the compound may have altered steric and electronic properties compared to its unsubstituted counterparts. In terms of safety, compounds containing hydrazine derivatives can be hazardous, often requiring careful handling due to their potential toxicity and reactivity. Overall, 4-Hydrazino-N-methylbenzeneethanesulfonamide is of interest in both synthetic chemistry and potential pharmaceutical applications, warranting further investigation into its properties and uses.
Formula:C9H15N3O2S
InChI:InChI=1/C9H15N3O2S/c1-11-15(13,14)7-6-8-2-4-9(12-10)5-3-8/h2-5,11-12H,6-7,10H2,1H3
SMILES:CNS(=O)(=O)CCc1ccc(cc1)NN
Synonyms:
  • 4-Hydrazino-N-methtylbenzeneethane sulfonamide
  • 2-(4-hydrazinylphenyl)-N-methylethanesulfonamide
  • 2-(4-Hydrazino-phenyl)-ethanesulfonic acid methylamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.