CAS 12168-31-9
:Strontium fluoride phosphate (Sr5F(PO4)3)
Description:
Strontium fluoride phosphate, with the chemical formula Sr5F(PO4)3, is an inorganic compound that belongs to the class of phosphates. It is characterized by its crystalline structure, typically forming in a hexagonal or rhombohedral lattice. This compound is notable for its incorporation of strontium ions, fluoride ions, and phosphate groups, which contribute to its unique properties. Strontium fluoride phosphate is often studied for its potential applications in materials science, particularly in the fields of luminescent materials and phosphors. It exhibits low solubility in water, making it stable under various environmental conditions. The presence of fluoride ions can enhance its optical properties, while the phosphate groups can influence its reactivity and interaction with other substances. Additionally, strontium fluoride phosphate is of interest in biological studies, as strontium is known to play a role in bone health. Overall, this compound presents a combination of interesting chemical and physical properties that make it valuable for various applications in both industrial and research settings.
Formula:F·O4P·Sr
InChI:InChI=1S/F.H3O4P.Sr/c;1-5(2,3)4;/h;(H3,1,2,3,4);/p-3
InChI key:InChIKey=CKVNOAOYNPKZSD-UHFFFAOYSA-K
SMILES:[F].P(=O)([O-])([O-])[O-].[Sr]
Synonyms:- Strontium phosphate fluoride (Sr5(PO4)3F)
- Strontium fluorapatite (Sr5(PO4)3F)
- Strontium fluoride phosphate (Sr5F(PO4)3)
- Strontium fluoride phosphate (Sr10F2(PO4)6)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
